1-((4-Hydrazinylbenzyl)sulfonyl)pyrrolidine hydrochloride CAS 334981-11-2

Product Name: 1-((4-Hydrazinylbenzyl)sulfonyl)pyrrolidine hydrochloride
Cas No.: 334981-11-2
Molecular Formula: C11H17N3O2S.ClH
Molecular Weight: 291.794
Appearance: White to crystalline powder
Density: 1.29±0.1 g/cm3
Purity: 95% Min
Solubility: Soluble in hot methanol, DMSO
Boiling point: 470.3°C at 760 mmHg
Melting point: N/A
Flash point: 238.2°C
Vapour: N/A
Refractive index: N/A
SMILES: S(CC1=CC=C(NN)C=C1)(=O)(=O)N2CCCC2.Cl
InChI Key: InChIKey=KDPFNFGHCNPPAI-UHFFFAOYSA-N
Other Names:
4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride
1-((4-(Hydrazino)benzenemethane)sulfonyl)pyrrolidine hydrochloride

4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride , also known as ‘Pyrrolidine, 1-[[(4-hydrazinylphenyl)methyl]sulfonyl]-, hydrochloride (1:1)’, ‘Pyrrolidine, 1-[[(4-hydrazinophenyl)methyl]sulfonyl]-, monohydrochloride’ or ‘1-((4-(Hydrazino)benzenemethane)sulfonyl)pyrrolidine hydrochloride’, is a chemical compound with a complex structure. It belongs to the class of pyrrolidine derivatives and exists as a hydrochloride salt. The compound consists of a pyrrolidine ring attached to a sulfonyl group, which is further connected to a benzene ring with a hydrazinylphenylmethyl group.

4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride possesses unique properties and potential applications in various fields, including pharmaceuticals, chemical synthesis, or research. It is commonly employed as an intermediate in the production of Almotriptan.

1. Chemical Structure: It is a compound with the molecular formula C12H18ClN3O2S and a specific molecular arrangement that includes a pyrrolidine ring and a sulfonamide group.
2. Solid Form: It is typically found as a crystalline solid, often appearing as a white powder.
3. Stability: The hydrochloride form of 4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride is relatively stable under normal conditions, allowing for ease of handling and storage.
4. Solubility: It exhibits solubility in certain solvents, such as hot methanol and DMSO, which can vary depending on the specific conditions and temperature.
5. Pharmacological Properties: As an intermediate in the synthesis of Almotriptan, 4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride plays a crucial role in the development of pharmaceutical compounds with potential therapeutic effects.

1. Intermediate in Drug Synthesis
This compound serves as an important intermediate in the synthesis of pharmaceutical agents and drug candidates. For example, it can be used as an intermediate in the production of Almotriptan. It also can be used as a building block to create structurally complex molecules with potential therapeutic properties.
2. Medicinal Chemistry
Pyrrolidine, 4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride plays a role in the development and research of novel drugs, particularly those related to central nervous system disorders, cardiovascular conditions, and other therapeutic areas.
3. Chemical Synthesis
It can be utilized as a reagent or catalyst in various chemical reactions and transformations, enabling the synthesis of diverse compounds and materials.
4. Biochemical Studies
The compound may find application in biochemical and biological studies, such as investigating the interaction between molecules, understanding biological pathways, and exploring drug-receptor interactions.
5. Research and Development
Pyrrolidine, 4-(1-Pyrrolidinylsulforylmenthyl)phenylhydrazine hydrochloride is often employed in research laboratories and academic institutions as a tool for studying the structure-activity relationship of different molecules and exploring their potential applications.

Keep in dark place, sealed in dry, room temperature.

25kg/bag or as per your particular request.